C14H20IN3O — CID 83202747
4-(3-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 83202747) has the molecular formula C14H20IN3O and a molecular weight of 373.24 g/mol. Its IUPAC name is 4-(3-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-(3-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 83202747 |
| Molecular Formula | C14H20IN3O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-(3-iodoanilino)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(Nc2cccc(I)c2)CC1 |
| InChI | InChI=1S/C14H20IN3O/c1-17(2)14(19)18-8-6-12(7-9-18)16-13-5-3-4-11(15)10-13/h3-5,10,12,16H,6-9H2,1-2H3 |
| InChIKey | OGJHYIUQWOVPDG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|