C19H24N4O2 — CID 86785141
N,N-dimethyl-4-(3-pyridin-2-yloxyanilino)piperidine-1-carboxamide (PubChem CID 86785141) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N,N-dimethyl-4-(3-pyridin-2-yloxyanilino)piperidine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-(3-pyridin-2-yloxyanilino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 86785141 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N,N-dimethyl-4-(3-pyridin-2-yloxyanilino)piperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(Nc2cccc(Oc3ccccn3)c2)CC1 |
| InChI | InChI=1S/C19H24N4O2/c1-22(2)19(24)23-12-9-15(10-13-23)21-16-6-5-7-17(14-16)25-18-8-3-4-11-20-18/h3-8,11,14-15,21H,9-10,12-13H2,1-2H3 |
| InChIKey | ZJPIPMNUZUAHIS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |