C19H23Cl2N3O2 — CID 119884835
3-amino-N-(3-pyridin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride (PubChem CID 119884835) has the molecular formula C19H23Cl2N3O2 and a molecular weight of 396.32 g/mol. Its IUPAC name is 3-amino-N-(3-pyridin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(3-pyridin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119884835 |
| Molecular Formula | C19H23Cl2N3O2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-amino-N-(3-pyridin-2-yloxyphenyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC1C2CCC(C2)C1C(=O)Nc1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C19H21N3O2.2ClH/c20-18-13-8-7-12(10-13)17(18)19(23)22-14-4-3-5-15(11-14)24-16-6-1-2-9-21-16;;/h1-6,9,11-13,17-18H,7-8,10,20H2,(H,22,23);2*1H |
| InChIKey | JRLCPRJHHIWVCV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |