C14H21Cl2N3O — CID 119832843
3-amino-N-(2-methyl-4-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride (PubChem CID 119832843) has the molecular formula C14H21Cl2N3O and a molecular weight of 318.25 g/mol. Its IUPAC name is 3-amino-N-(2-methyl-4-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride.
| Compound Name | 3-amino-N-(2-methyl-4-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119832843 |
| Molecular Formula | C14H21Cl2N3O |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-amino-N-(2-methyl-4-pyridinyl)bicyclo[2.2.1]heptane-2-carboxamide;dihydrochloride |
| SMILES | Cc1cc(NC(=O)C2C3CCC(C3)C2N)ccn1.Cl.Cl |
| InChI | InChI=1S/C14H19N3O.2ClH/c1-8-6-11(4-5-16-8)17-14(18)12-9-2-3-10(7-9)13(12)15;;/h4-6,9-10,12-13H,2-3,7,15H2,1H3,(H,16,17,18);2*1H |
| InChIKey | RZTTTXAVXUNALQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |