C22H22F3N5O2S — CID 3727973
4-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide (PubChem CID 3727973) has the molecular formula C22H22F3N5O2S and a molecular weight of 477.51 g/mol. Its IUPAC name is 4-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3727973 |
| Molecular Formula | C22H22F3N5O2S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 4-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-N-[4-(trifluoromethoxy)phenyl]-1,4-diazepane-1-carbothioamide |
| SMILES | FC(F)(F)Oc1ccc(NC(=S)N2CCCN(Cc3noc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H22F3N5O2S/c23-22(24,25)31-18-9-7-17(8-10-18)26-21(33)30-12-4-11-29(13-14-30)15-19-27-20(32-28-19)16-5-2-1-3-6-16/h1-3,5-10H,4,11-15H2,(H,26,33) |
| InChIKey | TZEQTAZZIUNACL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|