C21H27F3N4O2 — CID 90733645
ethane;1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 90733645) has the molecular formula C21H27F3N4O2 and a molecular weight of 424.47 g/mol. Its IUPAC name is ethane;1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | ethane;1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 90733645 |
| Molecular Formula | C21H27F3N4O2 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | ethane;1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CC.O=C(Nc1ccc(OC(F)(F)F)cc1)NC1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C19H21F3N4O2.C2H6/c20-19(21,22)28-17-3-1-15(2-4-17)24-18(27)25-16-7-11-26(12-8-16)13-14-5-9-23-10-6-14;1-2/h1-6,9-10,16H,7-8,11-13H2,(H2,24,25,27);1-2H3 |
| InChIKey | ZWTNYOMPGKXUFR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |