C15H17F3IN3O3 — CID 68950094
1-[1-(2-iodoacetyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 68950094) has the molecular formula C15H17F3IN3O3 and a molecular weight of 471.22 g/mol. Its IUPAC name is 1-[1-(2-iodoacetyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[1-(2-iodoacetyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 68950094 |
| Molecular Formula | C15H17F3IN3O3 |
| Molecular Weight | 471.22 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 1-[1-(2-iodoacetyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)NC1CCN(C(=O)CI)CC1 |
| InChI | InChI=1S/C15H17F3IN3O3/c16-15(17,18)25-12-3-1-10(2-4-12)20-14(24)21-11-5-7-22(8-6-11)13(23)9-19/h1-4,11H,5-9H2,(H2,20,21,24) |
| InChIKey | ZSUATBLDYOOQRN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|