C16H22F3N3O3S — CID 145475075
1-[1-(3-hydroxypropylsulfanyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 145475075) has the molecular formula C16H22F3N3O3S and a molecular weight of 393.43 g/mol. Its IUPAC name is 1-[1-(3-hydroxypropylsulfanyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[1-(3-hydroxypropylsulfanyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 145475075 |
| Molecular Formula | C16H22F3N3O3S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-[1-(3-hydroxypropylsulfanyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)NC1CCN(SCCCO)CC1 |
| InChI | InChI=1S/C16H22F3N3O3S/c17-16(18,19)25-14-4-2-12(3-5-14)20-15(24)21-13-6-8-22(9-7-13)26-11-1-10-23/h2-5,13,23H,1,6-11H2,(H2,20,21,24) |
| InChIKey | ISDRIJBABMEMDX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|