C18H26F2N3O4P — CID 178000564
tert-butyl 4-[[4-[difluoro(phosphanyl)methoxy]phenyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 178000564) has the molecular formula C18H26F2N3O4P and a molecular weight of 417.39 g/mol. Its IUPAC name is tert-butyl 4-[[4-[difluoro(phosphanyl)methoxy]phenyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[difluoro(phosphanyl)methoxy]phenyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178000564 |
| Molecular Formula | C18H26F2N3O4P |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | tert-butyl 4-[[4-[difluoro(phosphanyl)methoxy]phenyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)Nc2ccc(OC(F)(F)P)cc2)CC1 |
| InChI | InChI=1S/C18H26F2N3O4P/c1-17(2,3)27-16(25)23-10-8-13(9-11-23)22-15(24)21-12-4-6-14(7-5-12)26-18(19,20)28/h4-7,13H,8-11,28H2,1-3H3,(H2,21,22,24) |
| InChIKey | MOISCDQNGOAGTG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|