C19H29N7O3 — CID 70991380
tert-butyl 4-[[4-[N-(methylideneamino)carbamohydrazonoyl]phenyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 70991380) has the molecular formula C19H29N7O3 and a molecular weight of 403.49 g/mol. Its IUPAC name is tert-butyl 4-[[4-[N-(methylideneamino)carbamohydrazonoyl]phenyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[N-(methylideneamino)carbamohydrazonoyl]phenyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70991380 |
| Molecular Formula | C19H29N7O3 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | tert-butyl 4-[[4-[N-(methylideneamino)carbamohydrazonoyl]phenyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | C=NNC(=NN)c1ccc(NC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H29N7O3/c1-19(2,3)29-18(28)26-11-9-15(10-12-26)23-17(27)22-14-7-5-13(6-8-14)16(24-20)25-21-4/h5-8,15H,4,9-12,20H2,1-3H3,(H,24,25)(H2,22,23,27) |
| InChIKey | LKHKXGBFNHAEDQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|