C17H25N3O5S — CID 25071103
tert-butyl 4-[(5-methoxycarbonylthiophen-2-yl)carbamoylamino]piperidine-1-carboxylate (PubChem CID 25071103) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl 4-[(5-methoxycarbonylthiophen-2-yl)carbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-methoxycarbonylthiophen-2-yl)carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25071103 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | tert-butyl 4-[(5-methoxycarbonylthiophen-2-yl)carbamoylamino]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)s1 |
| InChI | InChI=1S/C17H25N3O5S/c1-17(2,3)25-16(23)20-9-7-11(8-10-20)18-15(22)19-13-6-5-12(26-13)14(21)24-4/h5-6,11H,7-10H2,1-4H3,(H2,18,19,22) |
| InChIKey | UMAKBXVXVVDSKK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |