C18H26N2O4S — CID 55985864
tert-butyl 4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]piperidine-1-carboxylate (PubChem CID 55985864) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is tert-butyl 4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55985864 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | tert-butyl 4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)CCC(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H26N2O4S/c1-18(2,3)24-17(23)20-10-8-13(9-11-20)19-16(22)7-6-14(21)15-5-4-12-25-15/h4-5,12-13H,6-11H2,1-3H3,(H,19,22) |
| InChIKey | RKULVVMXLULMRN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |