C19H27N7O3 — CID 55808806
tert-butyl 4-[[3-(1-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate (PubChem CID 55808806) has the molecular formula C19H27N7O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is tert-butyl 4-[[3-(1-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(1-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55808806 |
| Molecular Formula | C19H27N7O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | tert-butyl 4-[[3-(1-methyltetrazol-5-yl)phenyl]carbamoylamino]piperidine-1-carboxylate |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C19H27N7O3/c1-19(2,3)29-18(28)26-10-8-14(9-11-26)20-17(27)21-15-7-5-6-13(12-15)16-22-23-24-25(16)4/h5-7,12,14H,8-11H2,1-4H3,(H2,20,21,27) |
| InChIKey | RXBYQPRRPIYQEH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |