C17H25N7O2 — CID 55698753
1-(2-methyl-2-morpholin-4-ylpropyl)-3-[3-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 55698753) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[3-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 55698753 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-(2-methyl-2-morpholin-4-ylpropyl)-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)NCC(C)(C)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H25N7O2/c1-17(2,24-7-9-26-10-8-24)12-18-16(25)19-14-6-4-5-13(11-14)15-20-21-22-23(15)3/h4-6,11H,7-10,12H2,1-3H3,(H2,18,19,25) |
| InChIKey | NPEHXQLSKDMMSX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |