C18H24N6O3 — CID 51052710
N-(2-methyl-2-morpholin-4-ylpropyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide (PubChem CID 51052710) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-(2-methyl-2-morpholin-4-ylpropyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide.
| Compound Name | N-(2-methyl-2-morpholin-4-ylpropyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51052710 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-(2-methyl-2-morpholin-4-ylpropyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide |
| SMILES | CC(C)(CNC(=O)C(=O)Nc1cccc(-n2cnnc2)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H24N6O3/c1-18(2,24-6-8-27-9-7-24)11-19-16(25)17(26)22-14-4-3-5-15(10-14)23-12-20-21-13-23/h3-5,10,12-13H,6-9,11H2,1-2H3,(H,19,25)(H,22,26) |
| InChIKey | NHOOCOSEFKIUSP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|