C17H28N4O3S2 — CID 8684485
1-[3-(dimethylsulfamoyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea (PubChem CID 8684485) has the molecular formula C17H28N4O3S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8684485 |
| Molecular Formula | C17H28N4O3S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=S)NCC(C)(C)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H28N4O3S2/c1-17(2,21-8-10-24-11-9-21)13-18-16(25)19-14-6-5-7-15(12-14)26(22,23)20(3)4/h5-7,12H,8-11,13H2,1-4H3,(H2,18,19,25) |
| InChIKey | NONQXWVSHSNHQF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|