C20H31N5O5S — CID 43039662
N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide (PubChem CID 43039662) has the molecular formula C20H31N5O5S and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 43039662 |
| Molecular Formula | C20H31N5O5S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CN2CCN(C(=O)CN3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C20H31N5O5S/c1-22(2)31(28,29)18-5-3-4-17(14-18)21-19(26)15-23-6-8-25(9-7-23)20(27)16-24-10-12-30-13-11-24/h3-5,14H,6-13,15-16H2,1-2H3,(H,21,26) |
| InChIKey | XPALXSBHKAUBDN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |