C22H29N3O3S — CID 8904565
2-(4-benzylpiperidin-1-yl)-N-[3-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 8904565) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-[3-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8904565 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-[3-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)CN2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H29N3O3S/c1-24(2)29(27,28)21-10-6-9-20(16-21)23-22(26)17-25-13-11-19(12-14-25)15-18-7-4-3-5-8-18/h3-10,16,19H,11-15,17H2,1-2H3,(H,23,26) |
| InChIKey | VGLQTUNVVPAXCS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |