C16H23N3O5S2 — CID 8549718
methyl (2R)-4-[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]thiomorpholine-2-carboxylate (PubChem CID 8549718) has the molecular formula C16H23N3O5S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl (2R)-4-[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2R)-4-[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 8549718 |
| Molecular Formula | C16H23N3O5S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | methyl (2R)-4-[2-[3-(dimethylsulfamoyl)anilino]-2-oxoethyl]thiomorpholine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CN(CC(=O)Nc2cccc(S(=O)(=O)N(C)C)c2)CCS1 |
| InChI | InChI=1S/C16H23N3O5S2/c1-18(2)26(22,23)13-6-4-5-12(9-13)17-15(20)11-19-7-8-25-14(10-19)16(21)24-3/h4-6,9,14H,7-8,10-11H2,1-3H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | IOTJKAHSAXOHBD-CQSZACIVSA-N |
| XLogP | 0.47 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |