C18H24ClN5O5 — CID 55498242
N-(4-chloro-3-nitrophenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide (PubChem CID 55498242) has the molecular formula C18H24ClN5O5 and a molecular weight of 425.87 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55498242 |
| Molecular Formula | C18H24ClN5O5 |
| Molecular Weight | 425.87 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-2-[4-(2-morpholin-4-ylacetyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CN2CCOCC2)CC1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H24ClN5O5/c19-15-2-1-14(11-16(15)24(27)28)20-17(25)12-21-3-5-23(6-4-21)18(26)13-22-7-9-29-10-8-22/h1-2,11H,3-10,12-13H2,(H,20,25) |
| InChIKey | CCAPRYZWTGZNPW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.87 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|