C16H21ClN4O3 — CID 124743554
2-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-N-(4-chloro-3-nitrophenyl)acetamide (PubChem CID 124743554) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is 2-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-N-(4-chloro-3-nitrophenyl)acetamide.
| Compound Name | 2-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-N-(4-chloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124743554 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-[(9aS)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-N-(4-chloro-3-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCN2CCCC[C@H]2C1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21ClN4O3/c17-14-5-4-12(9-15(14)21(23)24)18-16(22)11-19-7-8-20-6-2-1-3-13(20)10-19/h4-5,9,13H,1-3,6-8,10-11H2,(H,18,22)/t13-/m0/s1 |
| InChIKey | ZANXALPXQAGQQA-ZDUSSCGKSA-N |
| XLogP | 2.36 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|