C15H21ClN4O — CID 79928265
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-amino-4-chlorophenyl)acetamide (PubChem CID 79928265) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-amino-4-chlorophenyl)acetamide.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-amino-4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 79928265 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(3-amino-4-chlorophenyl)acetamide |
| SMILES | Nc1cc(NC(=O)CN2CCN3CCCC3C2)ccc1Cl |
| InChI | InChI=1S/C15H21ClN4O/c16-13-4-3-11(8-14(13)17)18-15(21)10-19-6-7-20-5-1-2-12(20)9-19/h3-4,8,12H,1-2,5-7,9-10,17H2,(H,18,21) |
| InChIKey | CKGXDEXSWOQYNT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|