C15H19ClN4O3 — CID 27518345
2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(2-chloro-5-nitrophenyl)acetamide (PubChem CID 27518345) has the molecular formula C15H19ClN4O3 and a molecular weight of 338.80 g/mol. Its IUPAC name is 2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(2-chloro-5-nitrophenyl)acetamide.
| Compound Name | 2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(2-chloro-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 27518345 |
| Molecular Formula | C15H19ClN4O3 |
| Molecular Weight | 338.80 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-N-(2-chloro-5-nitrophenyl)acetamide |
| SMILES | O=C(CN1CCN2CCC[C@@H]2C1)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H19ClN4O3/c16-13-4-3-11(20(22)23)8-14(13)17-15(21)10-18-6-7-19-5-1-2-12(19)9-18/h3-4,8,12H,1-2,5-7,9-10H2,(H,17,21)/t12-/m1/s1 |
| InChIKey | HRIZPXKGDJRAJT-GFCCVEGCSA-N |
| XLogP | 1.97 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|