C15H18Cl3N3O — CID 17276248
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 17276248) has the molecular formula C15H18Cl3N3O and a molecular weight of 362.69 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 17276248 |
| Molecular Formula | C15H18Cl3N3O |
| Molecular Weight | 362.69 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(CN1CCN2CCCC2C1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl3N3O/c16-11-6-13(18)14(7-12(11)17)19-15(22)9-20-4-5-21-3-1-2-10(21)8-20/h6-7,10H,1-5,8-9H2,(H,19,22) |
| InChIKey | OKXWXJCLKBRIFV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|