C19H18Cl3N3O3 — CID 43926130
N-(2-chloro-5-nitrophenyl)-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43926130) has the molecular formula C19H18Cl3N3O3 and a molecular weight of 442.73 g/mol. Its IUPAC name is N-(2-chloro-5-nitrophenyl)-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-chloro-5-nitrophenyl)-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43926130 |
| Molecular Formula | C19H18Cl3N3O3 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-(2-chloro-5-nitrophenyl)-1-[(2,6-dichlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1Cl)C1CCCN(Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C19H18Cl3N3O3/c20-15-4-1-5-16(21)14(15)11-24-8-2-3-12(10-24)19(26)23-18-9-13(25(27)28)6-7-17(18)22/h1,4-7,9,12H,2-3,8,10-11H2,(H,23,26) |
| InChIKey | BDQPGSPSZVTKDD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|