C12H16ClN3O3 — CID 106668021
N-(3-amino-4-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide (PubChem CID 106668021) has the molecular formula C12H16ClN3O3 and a molecular weight of 285.73 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 106668021 |
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide |
| SMILES | Nc1cc(NC(=O)CN2CC(O)C(O)C2)ccc1Cl |
| InChI | InChI=1S/C12H16ClN3O3/c13-8-2-1-7(3-9(8)14)15-12(19)6-16-4-10(17)11(18)5-16/h1-3,10-11,17-18H,4-6,14H2,(H,15,19) |
| InChIKey | SWPCZLIEPLGNBG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|