C14H20ClN3O3 — CID 106668037
N-(3-amino-4-chlorophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide (PubChem CID 106668037) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.78 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 106668037 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide |
| SMILES | Nc1cc(NC(=O)CCCN2CC(O)C(O)C2)ccc1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c15-10-4-3-9(6-11(10)16)17-14(21)2-1-5-18-7-12(19)13(20)8-18/h3-4,6,12-13,19-20H,1-2,5,7-8,16H2,(H,17,21) |
| InChIKey | JXVBELHAYHDWMP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|