C14H15ClN4O2 — CID 62849241
N-(3-amino-4-chlorophenyl)-4-(6-oxopyridazin-1-yl)butanamide (PubChem CID 62849241) has the molecular formula C14H15ClN4O2 and a molecular weight of 306.75 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-4-(6-oxopyridazin-1-yl)butanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-4-(6-oxopyridazin-1-yl)butanamide |
|---|---|
| PubChem CID | 62849241 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-4-(6-oxopyridazin-1-yl)butanamide |
| SMILES | Nc1cc(NC(=O)CCCn2ncccc2=O)ccc1Cl |
| InChI | InChI=1S/C14H15ClN4O2/c15-11-6-5-10(9-12(11)16)18-13(20)3-2-8-19-14(21)4-1-7-17-19/h1,4-7,9H,2-3,8,16H2,(H,18,20) |
| InChIKey | DKOLOKVTKWJRIB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|