C13H15ClN4O2 — CID 80579065
N-(3-amino-4-chlorophenyl)-3-(3-methyl-2-oxoimidazol-1-yl)propanamide (PubChem CID 80579065) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3-(3-methyl-2-oxoimidazol-1-yl)propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3-(3-methyl-2-oxoimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 80579065 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3-(3-methyl-2-oxoimidazol-1-yl)propanamide |
| SMILES | Cn1ccn(CCC(=O)Nc2ccc(Cl)c(N)c2)c1=O |
| InChI | InChI=1S/C13H15ClN4O2/c1-17-6-7-18(13(17)20)5-4-12(19)16-9-2-3-10(14)11(15)8-9/h2-3,6-8H,4-5,15H2,1H3,(H,16,19) |
| InChIKey | BJVZBLUWLZKCGL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|