C14H18ClN5O4 — CID 71857133
N-(4-chloro-3-nitrophenyl)-4-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxamide (PubChem CID 71857133) has the molecular formula C14H18ClN5O4 and a molecular weight of 355.78 g/mol. Its IUPAC name is N-(4-chloro-3-nitrophenyl)-4-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxamide.
| Compound Name | N-(4-chloro-3-nitrophenyl)-4-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 71857133 |
| Molecular Formula | C14H18ClN5O4 |
| Molecular Weight | 355.78 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(4-chloro-3-nitrophenyl)-4-[2-(methylamino)-2-oxoethyl]piperazine-1-carboxamide |
| SMILES | CNC(=O)CN1CCN(C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C14H18ClN5O4/c1-16-13(21)9-18-4-6-19(7-5-18)14(22)17-10-2-3-11(15)12(8-10)20(23)24/h2-3,8H,4-7,9H2,1H3,(H,16,21)(H,17,22) |
| InChIKey | DNKBKJMBJRWHNJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.78 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|