C14H18ClN3O3 — CID 27493583
(3R,5R)-N-(4-chloro-3-nitrophenyl)-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 27493583) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is (3R,5R)-N-(4-chloro-3-nitrophenyl)-3,5-dimethylpiperidine-1-carboxamide.
| Compound Name | (3R,5R)-N-(4-chloro-3-nitrophenyl)-3,5-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 27493583 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (3R,5R)-N-(4-chloro-3-nitrophenyl)-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-9-5-10(2)8-17(7-9)14(19)16-11-3-4-12(15)13(6-11)18(20)21/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,16,19)/t9-,10-/m1/s1 |
| InChIKey | RTEBSOYOPFEXJX-NXEZZACHSA-N |
| XLogP | 3.76 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|