C15H19N3O5 — CID 122101780
5-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-3-carboxylic acid (PubChem CID 122101780) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122101780 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-3-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)N2CC(C)CC(C(=O)O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O5/c1-9-5-11(14(19)20)8-17(7-9)15(21)16-12-4-3-10(2)13(6-12)18(22)23/h3-4,6,9,11H,5,7-8H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | KPCUYBJGCACICQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|