C15H19N3O5 — CID 100618454
(2S,4R)-4-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-2-carboxylic acid (PubChem CID 100618454) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is (2S,4R)-4-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 100618454 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2S,4R)-4-methyl-1-[(4-methyl-3-nitrophenyl)carbamoyl]piperidine-2-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)N2CC[C@@H](C)C[C@H]2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O5/c1-9-5-6-17(13(7-9)14(19)20)15(21)16-11-4-3-10(2)12(8-11)18(22)23/h3-4,8-9,13H,5-7H2,1-2H3,(H,16,21)(H,19,20)/t9-,13+/m1/s1 |
| InChIKey | PPITVMRUTRQGLN-RNCFNFMXSA-N |
| XLogP | 2.62 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|