C19H22N4O3 — CID 87044150
N-[(6-methyl-2-pyridinyl)methyl]-N'-(3-morpholin-4-ylphenyl)oxamide (PubChem CID 87044150) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[(6-methyl-2-pyridinyl)methyl]-N'-(3-morpholin-4-ylphenyl)oxamide.
| Compound Name | N-[(6-methyl-2-pyridinyl)methyl]-N'-(3-morpholin-4-ylphenyl)oxamide |
|---|---|
| PubChem CID | 87044150 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[(6-methyl-2-pyridinyl)methyl]-N'-(3-morpholin-4-ylphenyl)oxamide |
| SMILES | Cc1cccc(CNC(=O)C(=O)Nc2cccc(N3CCOCC3)c2)n1 |
| InChI | InChI=1S/C19H22N4O3/c1-14-4-2-6-16(21-14)13-20-18(24)19(25)22-15-5-3-7-17(12-15)23-8-10-26-11-9-23/h2-7,12H,8-11,13H2,1H3,(H,20,24)(H,22,25) |
| InChIKey | ZVCQPOAIMHWOQO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|