C19H17N5O4 — CID 51052929
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide (PubChem CID 51052929) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 51052929 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N'-[3-(1,2,4-triazol-4-yl)phenyl]oxamide |
| SMILES | O=C(NCC1COc2ccccc2O1)C(=O)Nc1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C19H17N5O4/c25-18(20-9-15-10-27-16-6-1-2-7-17(16)28-15)19(26)23-13-4-3-5-14(8-13)24-11-21-22-12-24/h1-8,11-12,15H,9-10H2,(H,20,25)(H,23,26) |
| InChIKey | NDOCQDNZJBXQRE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|