C21H24N2O4 — CID 108502535
N'-(4-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)oxamide (PubChem CID 108502535) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N'-(4-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)oxamide.
| Compound Name | N'-(4-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108502535 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N'-(4-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)oxamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)NCC2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-2-3-6-15-9-11-16(12-10-15)23-21(25)20(24)22-13-17-14-26-18-7-4-5-8-19(18)27-17/h4-5,7-12,17H,2-3,6,13-14H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | HRQJFWKJIAHKBI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|