C14H21N7O — CID 69111932
1-[4-(methylamino)butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 69111932) has the molecular formula C14H21N7O and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[4-(methylamino)butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[4-(methylamino)butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 69111932 |
| Molecular Formula | C14H21N7O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[4-(methylamino)butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | CNCCCCNC(=O)Nc1cccc(-c2nnnn2C)c1 |
| InChI | InChI=1S/C14H21N7O/c1-15-8-3-4-9-16-14(22)17-12-7-5-6-11(10-12)13-18-19-20-21(13)2/h5-7,10,15H,3-4,8-9H2,1-2H3,(H2,16,17,22) |
| InChIKey | QNHBCSAOOBDLAZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|