C25H33N7O — CID 59862593
1-[4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 59862593) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 1-[4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 59862593 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-[4-[cyclopropyl-[(3,4-dimethylphenyl)methyl]amino]butyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | Cc1ccc(CN(CCCCNC(=O)Nc2cccc(-c3nnnn3C)c2)C2CC2)cc1C |
| InChI | InChI=1S/C25H33N7O/c1-18-9-10-20(15-19(18)2)17-32(23-11-12-23)14-5-4-13-26-25(33)27-22-8-6-7-21(16-22)24-28-29-30-31(24)3/h6-10,15-16,23H,4-5,11-14,17H2,1-3H3,(H2,26,27,33) |
| InChIKey | IRYJMNOBTWKSRP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|