C20H25FN8O — CID 69224343
1-[4-[2-(4-fluorophenyl)ethylamino]butyl]-3-[5-(1-methyltetrazol-5-yl)-3-pyridinyl]urea (PubChem CID 69224343) has the molecular formula C20H25FN8O and a molecular weight of 412.47 g/mol. Its IUPAC name is 1-[4-[2-(4-fluorophenyl)ethylamino]butyl]-3-[5-(1-methyltetrazol-5-yl)-3-pyridinyl]urea.
| Compound Name | 1-[4-[2-(4-fluorophenyl)ethylamino]butyl]-3-[5-(1-methyltetrazol-5-yl)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 69224343 |
| Molecular Formula | C20H25FN8O |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 1-[4-[2-(4-fluorophenyl)ethylamino]butyl]-3-[5-(1-methyltetrazol-5-yl)-3-pyridinyl]urea |
| SMILES | Cn1nnnc1-c1cncc(NC(=O)NCCCCNCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H25FN8O/c1-29-19(26-27-28-29)16-12-18(14-23-13-16)25-20(30)24-10-3-2-9-22-11-8-15-4-6-17(21)7-5-15/h4-7,12-14,22H,2-3,8-11H2,1H3,(H2,24,25,30) |
| InChIKey | MWNARVZTQGAHMN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|