C24H30FN7O3 — CID 69112006
2-ethyl-3-[4-[(4-fluorophenyl)methyl-methylamino]butylcarbamoylamino]-5-(1-methyltetrazol-5-yl)benzoic acid (PubChem CID 69112006) has the molecular formula C24H30FN7O3 and a molecular weight of 483.55 g/mol. Its IUPAC name is 2-ethyl-3-[4-[(4-fluorophenyl)methyl-methylamino]butylcarbamoylamino]-5-(1-methyltetrazol-5-yl)benzoic acid.
| Compound Name | 2-ethyl-3-[4-[(4-fluorophenyl)methyl-methylamino]butylcarbamoylamino]-5-(1-methyltetrazol-5-yl)benzoic acid |
|---|---|
| PubChem CID | 69112006 |
| Molecular Formula | C24H30FN7O3 |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-ethyl-3-[4-[(4-fluorophenyl)methyl-methylamino]butylcarbamoylamino]-5-(1-methyltetrazol-5-yl)benzoic acid |
| SMILES | CCc1c(NC(=O)NCCCCN(C)Cc2ccc(F)cc2)cc(-c2nnnn2C)cc1C(=O)O |
| InChI | InChI=1S/C24H30FN7O3/c1-4-19-20(23(33)34)13-17(22-28-29-30-32(22)3)14-21(19)27-24(35)26-11-5-6-12-31(2)15-16-7-9-18(25)10-8-16/h7-10,13-14H,4-6,11-12,15H2,1-3H3,(H,33,34)(H2,26,27,35) |
| InChIKey | NYGGAVKQXSTWPT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|