C26H36N8O2 — CID 59862646
3-[4-[(3,4-dimethylphenyl)methyl-methylamino]butylcarbamoylamino]-N,N-dimethyl-5-(1-methyltetrazol-5-yl)benzamide (PubChem CID 59862646) has the molecular formula C26H36N8O2 and a molecular weight of 492.63 g/mol. Its IUPAC name is 3-[4-[(3,4-dimethylphenyl)methyl-methylamino]butylcarbamoylamino]-N,N-dimethyl-5-(1-methyltetrazol-5-yl)benzamide.
| Compound Name | 3-[4-[(3,4-dimethylphenyl)methyl-methylamino]butylcarbamoylamino]-N,N-dimethyl-5-(1-methyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 59862646 |
| Molecular Formula | C26H36N8O2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | 3-[4-[(3,4-dimethylphenyl)methyl-methylamino]butylcarbamoylamino]-N,N-dimethyl-5-(1-methyltetrazol-5-yl)benzamide |
| SMILES | Cc1ccc(CN(C)CCCCNC(=O)Nc2cc(C(=O)N(C)C)cc(-c3nnnn3C)c2)cc1C |
| InChI | InChI=1S/C26H36N8O2/c1-18-9-10-20(13-19(18)2)17-33(5)12-8-7-11-27-26(36)28-23-15-21(24-29-30-31-34(24)6)14-22(16-23)25(35)32(3)4/h9-10,13-16H,7-8,11-12,17H2,1-6H3,(H2,27,28,36) |
| InChIKey | LVYJKGRVCZODST-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|