C25H35N7O — CID 59862603
1-[4-[(3,4-dimethylphenyl)methyl-methylamino]butyl]-3-[3-ethyl-5-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 59862603) has the molecular formula C25H35N7O and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-[4-[(3,4-dimethylphenyl)methyl-methylamino]butyl]-3-[3-ethyl-5-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[4-[(3,4-dimethylphenyl)methyl-methylamino]butyl]-3-[3-ethyl-5-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 59862603 |
| Molecular Formula | C25H35N7O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 1-[4-[(3,4-dimethylphenyl)methyl-methylamino]butyl]-3-[3-ethyl-5-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | CCc1cc(NC(=O)NCCCCN(C)Cc2ccc(C)c(C)c2)cc(-c2nnnn2C)c1 |
| InChI | InChI=1S/C25H35N7O/c1-6-20-14-22(24-28-29-30-32(24)5)16-23(15-20)27-25(33)26-11-7-8-12-31(4)17-21-10-9-18(2)19(3)13-21/h9-10,13-16H,6-8,11-12,17H2,1-5H3,(H2,26,27,33) |
| InChIKey | FVRJGZSACSCSOF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|