C22H26FN7O — CID 69112080
1-[[2-[[2-(4-fluorophenyl)ethylamino]methyl]cyclopropyl]methyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea (PubChem CID 69112080) has the molecular formula C22H26FN7O and a molecular weight of 423.50 g/mol. Its IUPAC name is 1-[[2-[[2-(4-fluorophenyl)ethylamino]methyl]cyclopropyl]methyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea.
| Compound Name | 1-[[2-[[2-(4-fluorophenyl)ethylamino]methyl]cyclopropyl]methyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 69112080 |
| Molecular Formula | C22H26FN7O |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-[[2-[[2-(4-fluorophenyl)ethylamino]methyl]cyclopropyl]methyl]-3-[3-(1-methyltetrazol-5-yl)phenyl]urea |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)NCC2CC2CNCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H26FN7O/c1-30-21(27-28-29-30)16-3-2-4-20(12-16)26-22(31)25-14-18-11-17(18)13-24-10-9-15-5-7-19(23)8-6-15/h2-8,12,17-18,24H,9-11,13-14H2,1H3,(H2,25,26,31) |
| InChIKey | QOAKWEVSQIQKPQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|