C17H18N6O2S — CID 26124033
N-[4-[3-(1-methyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 26124033) has the molecular formula C17H18N6O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is N-[4-[3-(1-methyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[3-(1-methyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 26124033 |
| Molecular Formula | C17H18N6O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[4-[3-(1-methyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | Cn1nnnc1-c1cccc(NC(=O)CCCNC(=O)c2ccsc2)c1 |
| InChI | InChI=1S/C17H18N6O2S/c1-23-16(20-21-22-23)12-4-2-5-14(10-12)19-15(24)6-3-8-18-17(25)13-7-9-26-11-13/h2,4-5,7,9-11H,3,6,8H2,1H3,(H,18,25)(H,19,24) |
| InChIKey | VLCUCWRIAVAQBJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|