C19H20N6O2S — CID 17496031
N-[4-[3-(1-cyclopropyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide (PubChem CID 17496031) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[4-[3-(1-cyclopropyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[3-(1-cyclopropyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17496031 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[4-[3-(1-cyclopropyltetrazol-5-yl)anilino]-4-oxobutyl]thiophene-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccsc1)Nc1cccc(-c2nnnn2C2CC2)c1 |
| InChI | InChI=1S/C19H20N6O2S/c26-17(5-2-9-20-19(27)14-8-10-28-12-14)21-15-4-1-3-13(11-15)18-22-23-24-25(18)16-6-7-16/h1,3-4,8,10-12,16H,2,5-7,9H2,(H,20,27)(H,21,26) |
| InChIKey | AOLNEEPPDDEXRZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|