C23H26N6O5S — CID 55505872
N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)butanamide (PubChem CID 55505872) has the molecular formula C23H26N6O5S and a molecular weight of 498.57 g/mol. Its IUPAC name is N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)butanamide.
| Compound Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 55505872 |
| Molecular Formula | C23H26N6O5S |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)butanamide |
| SMILES | O=C(CCCNS(=O)(=O)c1ccc2c(c1)OCCCO2)Nc1cccc(-c2nnnn2C2CC2)c1 |
| InChI | InChI=1S/C23H26N6O5S/c30-22(25-17-5-1-4-16(14-17)23-26-27-28-29(23)18-7-8-18)6-2-11-24-35(31,32)19-9-10-20-21(15-19)34-13-3-12-33-20/h1,4-5,9-10,14-15,18,24H,2-3,6-8,11-13H2,(H,25,30) |
| InChIKey | USGYYQCJFSOELU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|