C20H21N5OS — CID 24590710
N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-phenylsulfanylbutanamide (PubChem CID 24590710) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-phenylsulfanylbutanamide.
| Compound Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 24590710 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[3-(1-cyclopropyltetrazol-5-yl)phenyl]-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1cccc(-c2nnnn2C2CC2)c1 |
| InChI | InChI=1S/C20H21N5OS/c26-19(10-5-13-27-18-8-2-1-3-9-18)21-16-7-4-6-15(14-16)20-22-23-24-25(20)17-11-12-17/h1-4,6-9,14,17H,5,10-13H2,(H,21,26) |
| InChIKey | IZICCMZMZNIWSG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|