C20H31N3O3 — CID 108900871
tert-butyl 4-[2-(3-methylphenyl)ethylcarbamoylamino]piperidine-1-carboxylate (PubChem CID 108900871) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-methylphenyl)ethylcarbamoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-methylphenyl)ethylcarbamoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108900871 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | tert-butyl 4-[2-(3-methylphenyl)ethylcarbamoylamino]piperidine-1-carboxylate |
| SMILES | Cc1cccc(CCNC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-15-6-5-7-16(14-15)8-11-21-18(24)22-17-9-12-23(13-10-17)19(25)26-20(2,3)4/h5-7,14,17H,8-13H2,1-4H3,(H2,21,22,24) |
| InChIKey | SBPSDICHDKNSPJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |