C20H21F3N4O3S — CID 145475102
1-[1-(4-aminosulfanylbenzoyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 145475102) has the molecular formula C20H21F3N4O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 1-[1-(4-aminosulfanylbenzoyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[1-(4-aminosulfanylbenzoyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 145475102 |
| Molecular Formula | C20H21F3N4O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[1-(4-aminosulfanylbenzoyl)piperidin-4-yl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | NSc1ccc(C(=O)N2CCC(NC(=O)Nc3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21F3N4O3S/c21-20(22,23)30-16-5-3-14(4-6-16)25-19(29)26-15-9-11-27(12-10-15)18(28)13-1-7-17(31-24)8-2-13/h1-8,15H,9-12,24H2,(H2,25,26,29) |
| InChIKey | ZCYZGHPQSSBZCN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|