C18H19F3N4O2S — CID 89143382
1-(1-pyridin-3-ylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 89143382) has the molecular formula C18H19F3N4O2S and a molecular weight of 412.44 g/mol. Its IUPAC name is 1-(1-pyridin-3-ylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1-pyridin-3-ylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 89143382 |
| Molecular Formula | C18H19F3N4O2S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-(1-pyridin-3-ylsulfanylpiperidin-4-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)NC1CCN(Sc2cccnc2)CC1 |
| InChI | InChI=1S/C18H19F3N4O2S/c19-18(20,21)27-15-5-3-13(4-6-15)23-17(26)24-14-7-10-25(11-8-14)28-16-2-1-9-22-12-16/h1-6,9,12,14H,7-8,10-11H2,(H2,23,24,26) |
| InChIKey | GYMDEFAJGZRSIY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|